C18H28OSi — CID 86213014
3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-trimethylsilane (PubChem CID 86213014) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-trimethylsilane.
| Compound Name | 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-trimethylsilane |
|---|---|
| PubChem CID | 86213014 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-trimethylsilane |
| SMILES | CCC(CCO[Si](C)(C)C)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C18H28OSi/c1-5-18(16-10-6-7-11-16,17-12-8-9-13-17)14-15-19-20(2,3)4/h6-13,16-17H,5,14-15H2,1-4H3 |
| InChIKey | HTAMRQDUGPHEFM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|