C21H34OSi — CID 86212938
3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane (PubChem CID 86212938) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane.
| Compound Name | 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane |
|---|---|
| PubChem CID | 86212938 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 3,3-di(cyclopenta-2,4-dien-1-yl)pentoxy-triethylsilane |
| SMILES | CCC(CCO[Si](CC)(CC)CC)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/C21H34OSi/c1-5-21(19-13-9-10-14-19,20-15-11-12-16-20)17-18-22-23(6-2,7-3)8-4/h9-16,19-20H,5-8,17-18H2,1-4H3 |
| InChIKey | PQBWHMYXOHYNDY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|