C19H35LiOSi — CID 134942751
lithium [(2S)-2-[(1S)-4-methylcyclohexa-2,4-dien-1-yl]propoxy]-tri(propan-2-yl)silane (PubChem CID 134942751) has the molecular formula C19H35LiOSi and a molecular weight of 314.51 g/mol. Its IUPAC name is lithium [(2S)-2-[(1S)-4-methylcyclohexa-2,4-dien-1-yl]propoxy]-tri(propan-2-yl)silane.
| Compound Name | lithium [(2S)-2-[(1S)-4-methylcyclohexa-2,4-dien-1-yl]propoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134942751 |
| Molecular Formula | C19H35LiOSi |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | lithium [(2S)-2-[(1S)-4-methylcyclohexa-2,4-dien-1-yl]propoxy]-tri(propan-2-yl)silane |
| SMILES | CC1=CC[C@H]([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C=[C-]1.[Li+] |
| InChI | InChI=1S/C19H35OSi.Li/c1-14(2)21(15(3)4,16(5)6)20-13-18(8)19-11-9-17(7)10-12-19;/h9,12,14-16,18-19H,11,13H2,1-8H3;/q-1;+1/t18-,19+;/m1./s1 |
| InChIKey | IAPMZXCLODKKMN-VOMIJIAVSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|