C27H54O2Si2 — CID 134980490
[(1R,6R)-2-methyl-6-[tri(propan-2-yl)silyloxymethyl]cyclohexa-2,4-dien-1-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134980490) has the molecular formula C27H54O2Si2 and a molecular weight of 466.90 g/mol. Its IUPAC name is [(1R,6R)-2-methyl-6-[tri(propan-2-yl)silyloxymethyl]cyclohexa-2,4-dien-1-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,6R)-2-methyl-6-[tri(propan-2-yl)silyloxymethyl]cyclohexa-2,4-dien-1-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134980490 |
| Molecular Formula | C27H54O2Si2 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | [(1R,6R)-2-methyl-6-[tri(propan-2-yl)silyloxymethyl]cyclohexa-2,4-dien-1-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC1=CC=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H54O2Si2/c1-19(2)30(20(3)4,21(5)6)28-17-26-16-14-15-25(13)27(26)18-29-31(22(7)8,23(9)10)24(11)12/h14-16,19-24,26-27H,17-18H2,1-13H3/t26-,27-/m0/s1 |
| InChIKey | PPVNAYTYYNMBJX-SVBPBHIXSA-N |
| XLogP | 9.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|