C17H34O6Si2 — CID 163579598
trimethoxy-[2-[3-methyl-4-(2-trimethoxysilylethyl)cyclohexa-1,5-dien-1-yl]ethyl]silane (PubChem CID 163579598) has the molecular formula C17H34O6Si2 and a molecular weight of 390.63 g/mol. Its IUPAC name is trimethoxy-[2-[3-methyl-4-(2-trimethoxysilylethyl)cyclohexa-1,5-dien-1-yl]ethyl]silane.
| Compound Name | trimethoxy-[2-[3-methyl-4-(2-trimethoxysilylethyl)cyclohexa-1,5-dien-1-yl]ethyl]silane |
|---|---|
| PubChem CID | 163579598 |
| Molecular Formula | C17H34O6Si2 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | trimethoxy-[2-[3-methyl-4-(2-trimethoxysilylethyl)cyclohexa-1,5-dien-1-yl]ethyl]silane |
| SMILES | CO[Si](CCC1=CC(C)C(CC[Si](OC)(OC)OC)C=C1)(OC)OC |
| InChI | InChI=1S/C17H34O6Si2/c1-15-14-16(10-12-24(18-2,19-3)20-4)8-9-17(15)11-13-25(21-5,22-6)23-7/h8-9,14-15,17H,10-13H2,1-7H3 |
| InChIKey | GGJZCMNLPCEECP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|