C25H30N2O5 — CID 108927064
[3-[4-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108927064) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [3-[4-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927064 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [3-[4-[[[2-(2,4-dimethylphenoxy)acetyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(CNC(=O)COc3ccc(C)cc3C)CC2)c1 |
| InChI | InChI=1S/C25H30N2O5/c1-17-7-8-23(18(2)13-17)31-16-24(29)26-15-20-9-11-27(12-10-20)25(30)21-5-4-6-22(14-21)32-19(3)28/h4-8,13-14,20H,9-12,15-16H2,1-3H3,(H,26,29) |
| InChIKey | MALOWQIAZSDVKY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|