C14H21F3N2O3 — CID 108933083
2,2,2-trifluoro-N-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]acetamide (PubChem CID 108933083) has the molecular formula C14H21F3N2O3 and a molecular weight of 322.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108933083 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]acetamide |
| SMILES | O=C(CC1CCOCC1)N1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21F3N2O3/c15-14(16,17)13(21)18-11-1-5-19(6-2-11)12(20)9-10-3-7-22-8-4-10/h10-11H,1-9H2,(H,18,21) |
| InChIKey | HEMAOBNGJOIPGL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |