C19H25NO7 — CID 10894182
[(3S,3aR,4S,5S)-4,5-bis(methoxymethoxy)-3-methyl-4,5-dihydro-3aH-benzo[g][2,1]benzoxazol-3-yl]methyl acetate (PubChem CID 10894182) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is [(3S,3aR,4S,5S)-4,5-bis(methoxymethoxy)-3-methyl-4,5-dihydro-3aH-benzo[g][2,1]benzoxazol-3-yl]methyl acetate.
| Compound Name | [(3S,3aR,4S,5S)-4,5-bis(methoxymethoxy)-3-methyl-4,5-dihydro-3aH-benzo[g][2,1]benzoxazol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10894182 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [(3S,3aR,4S,5S)-4,5-bis(methoxymethoxy)-3-methyl-4,5-dihydro-3aH-benzo[g][2,1]benzoxazol-3-yl]methyl acetate |
| SMILES | COCO[C@H]1[C@H]2C(=NO[C@]2(C)COC(C)=O)c2ccccc2[C@@H]1OCOC |
| InChI | InChI=1S/C19H25NO7/c1-12(21)24-9-19(2)15-16(20-27-19)13-7-5-6-8-14(13)17(25-10-22-3)18(15)26-11-23-4/h5-8,15,17-18H,9-11H2,1-4H3/t15-,17+,18+,19-/m1/s1 |
| InChIKey | PKHZONBESVHDMG-XGXHKWSGSA-N |
| XLogP | 2.02 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|