C25H27NO5 — CID 10895098
methyl (E)-3-[3-[acetyl-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate (PubChem CID 10895098) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is methyl (E)-3-[3-[acetyl-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[acetyl-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10895098 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | methyl (E)-3-[3-[acetyl-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc3c(c2OC)OC(C)(C)C=C3)C(C)=O)c1 |
| InChI | InChI=1S/C25H27NO5/c1-17(27)26(21-8-6-7-18(15-21)9-12-22(28)29-4)16-20-11-10-19-13-14-25(2,3)31-24(19)23(20)30-5/h6-15H,16H2,1-5H3/b12-9+ |
| InChIKey | XIYYAVUKLQNMRQ-FMIVXFBMSA-N |
| XLogP | 4.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|