C31H31NO6 — CID 10984086
methyl (E)-3-[3-[(3-methoxybenzoyl)-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate (PubChem CID 10984086) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is methyl (E)-3-[3-[(3-methoxybenzoyl)-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(3-methoxybenzoyl)-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10984086 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | methyl (E)-3-[3-[(3-methoxybenzoyl)-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc3c(c2OC)OC(C)(C)C=C3)C(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C31H31NO6/c1-31(2)17-16-22-13-14-24(28(37-5)29(22)38-31)20-32(30(34)23-9-7-11-26(19-23)35-3)25-10-6-8-21(18-25)12-15-27(33)36-4/h6-19H,20H2,1-5H3/b15-12+ |
| InChIKey | FSMVPSXPFXEEBL-NTCAYCPXSA-N |
| XLogP | 5.92 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|