C21H33NO10 — CID 10895788
tert-butyl (3aR,4R,6aS)-4-[(1R,2R)-1,2-diacetyloxy-4-methoxy-4-oxobutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 10895788) has the molecular formula C21H33NO10 and a molecular weight of 459.49 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6aS)-4-[(1R,2R)-1,2-diacetyloxy-4-methoxy-4-oxobutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6aS)-4-[(1R,2R)-1,2-diacetyloxy-4-methoxy-4-oxobutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 10895788 |
| Molecular Formula | C21H33NO10 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | tert-butyl (3aR,4R,6aS)-4-[(1R,2R)-1,2-diacetyloxy-4-methoxy-4-oxobutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO10/c1-11(23)28-13(9-15(25)27-8)17(29-12(2)24)16-18-14(30-21(6,7)31-18)10-22(16)19(26)32-20(3,4)5/h13-14,16-18H,9-10H2,1-8H3/t13-,14+,16+,17+,18+/m1/s1 |
| InChIKey | HQFREMHRYRGRIR-SRIISGBFSA-N |
| XLogP | 1.55 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|