C10H14O4 — CID 10899593
(4aS,6S,7R,8aS)-6,7-dihydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione (PubChem CID 10899593) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (4aS,6S,7R,8aS)-6,7-dihydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione.
| Compound Name | (4aS,6S,7R,8aS)-6,7-dihydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10899593 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (4aS,6S,7R,8aS)-6,7-dihydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
| SMILES | O=C1CCC(=O)[C@H]2C[C@H](O)[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C10H14O4/c11-7-1-2-8(12)6-4-10(14)9(13)3-5(6)7/h5-6,9-10,13-14H,1-4H2/t5-,6-,9-,10+/m0/s1 |
| InChIKey | SDEYJHPERROOGA-AJSHEINVSA-N |
| XLogP | -0.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |