C17H22O2 — CID 10901310
1-ethynyl-3-[(E)-3-hydroxy-3-methylpent-1-en-4-ynyl]-2,4,4-trimethylcyclohex-2-en-1-ol (PubChem CID 10901310) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-ethynyl-3-[(E)-3-hydroxy-3-methylpent-1-en-4-ynyl]-2,4,4-trimethylcyclohex-2-en-1-ol.
| Compound Name | 1-ethynyl-3-[(E)-3-hydroxy-3-methylpent-1-en-4-ynyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10901310 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-ethynyl-3-[(E)-3-hydroxy-3-methylpent-1-en-4-ynyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
| SMILES | C#CC(C)(O)/C=C/C1=C(C)C(O)(C#C)CCC1(C)C |
| InChI | InChI=1S/C17H22O2/c1-7-16(6,18)10-9-14-13(3)17(19,8-2)12-11-15(14,4)5/h1-2,9-10,18-19H,11-12H2,3-6H3/b10-9+ |
| InChIKey | JLYUIWGYGLACNH-MDZDMXLPSA-N |
| XLogP | 2.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|