About 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol
3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol (PubChem CID 175497328) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol.
Molecular Properties
| Compound Name | 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol |
| PubChem CID | 175497328 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol |
| SMILES | C#CC(C)(O)C=CC1=C(C)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H22O/c1-6-15(5,16)11-9-13-8-7-10-14(3,4)12(13)2/h1,9,11,16H,7-8,10H2,2-5H3 |
| InChIKey | YDXDUKRZWQGTMX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol?
The IUPAC name of 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol (CID 175497328) is 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol.
What is the SMILES notation for 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol?
The canonical SMILES for 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol is C#CC(C)(O)C=CC1=C(C)C(C)(C)CCC1.
What is the InChIKey of 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol?
The InChIKey is YDXDUKRZWQGTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-6-15(5,16)11-9-13-8-7-10-14(3,4)12(13)2/h1,9,11,16H,7-8,10H2,2-5H3.
What are the key properties of 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol?
3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol has a molecular weight of 218.34 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(2,3,3-trimethylcyclohexen-1-yl)pent-1-en-4-yn-3-ol is sourced from PubChem (CID 175497328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).