C13H23N3O4S — CID 109017967
N-(1,1-dioxothiolan-3-yl)-3-(4-formylpiperazin-1-yl)-N-methylpropanamide (PubChem CID 109017967) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(4-formylpiperazin-1-yl)-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(4-formylpiperazin-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 109017967 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(4-formylpiperazin-1-yl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1CCN(C=O)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23N3O4S/c1-14(12-3-9-21(19,20)10-12)13(18)2-4-15-5-7-16(11-17)8-6-15/h11-12H,2-10H2,1H3 |
| InChIKey | NRGJTTHHQBXWCR-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|