C10H17NO5S2 — CID 43238044
3-[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43238044) has the molecular formula C10H17NO5S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43238044 |
| Molecular Formula | C10H17NO5S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | CN(C(=O)CSCCC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO5S2/c1-11(8-3-5-18(15,16)7-8)9(12)6-17-4-2-10(13)14/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | HIXRCABJDLBRAC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|