C20H38O3Si — CID 10904358
(R)-[(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]-[(1R,2R)-4-methyl-2-triethylsilyloxycyclohex-3-en-1-yl]methanol (PubChem CID 10904358) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (R)-[(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]-[(1R,2R)-4-methyl-2-triethylsilyloxycyclohex-3-en-1-yl]methanol.
| Compound Name | (R)-[(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]-[(1R,2R)-4-methyl-2-triethylsilyloxycyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 10904358 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (R)-[(2S,3S)-3-(2-methylpropyl)oxiran-2-yl]-[(1R,2R)-4-methyl-2-triethylsilyloxycyclohex-3-en-1-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C(C)CC[C@@H]1[C@@H](O)[C@@H]1O[C@H]1CC(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-7-24(8-2,9-3)23-17-13-15(6)10-11-16(17)19(21)20-18(22-20)12-14(4)5/h13-14,16-21H,7-12H2,1-6H3/t16-,17+,18-,19+,20+/m0/s1 |
| InChIKey | AWYVLISDKBRHGG-PXTPFGJHSA-N |
| XLogP | 4.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|