C22H42O3Si — CID 24865148
[(2S,3S)-3-[(E,2R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,7-trimethyl-4-methylidenenon-5-enyl]oxiran-2-yl]methanol (PubChem CID 24865148) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is [(2S,3S)-3-[(E,2R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,7-trimethyl-4-methylidenenon-5-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(E,2R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,7-trimethyl-4-methylidenenon-5-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 24865148 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [(2S,3S)-3-[(E,2R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,7-trimethyl-4-methylidenenon-5-enyl]oxiran-2-yl]methanol |
| SMILES | C=C(/C=C(\C)[C@@H](C)CCO[Si](C)(C)C(C)(C)C)C[C@@H](C)C[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C22H42O3Si/c1-16(12-17(2)14-20-21(15-23)25-20)13-19(4)18(3)10-11-24-26(8,9)22(5,6)7/h13,17-18,20-21,23H,1,10-12,14-15H2,2-9H3/b19-13+/t17-,18+,20+,21+/m1/s1 |
| InChIKey | DBAFLVXUYMQEQG-DGFGOUPJSA-N |
| XLogP | 5.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|