C17H16ClFN2O2S2 — CID 10905411
(2E)-N-[2-[(4-chlorophenyl)disulfanyl]ethyl]-3-(4-fluorophenyl)-2-hydroxyiminopropanamide (PubChem CID 10905411) has the molecular formula C17H16ClFN2O2S2 and a molecular weight of 398.91 g/mol. Its IUPAC name is (2E)-N-[2-[(4-chlorophenyl)disulfanyl]ethyl]-3-(4-fluorophenyl)-2-hydroxyiminopropanamide.
| Compound Name | (2E)-N-[2-[(4-chlorophenyl)disulfanyl]ethyl]-3-(4-fluorophenyl)-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 10905411 |
| Molecular Formula | C17H16ClFN2O2S2 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (2E)-N-[2-[(4-chlorophenyl)disulfanyl]ethyl]-3-(4-fluorophenyl)-2-hydroxyiminopropanamide |
| SMILES | O=C(NCCSSc1ccc(Cl)cc1)/C(Cc1ccc(F)cc1)=N/O |
| InChI | InChI=1S/C17H16ClFN2O2S2/c18-13-3-7-15(8-4-13)25-24-10-9-20-17(22)16(21-23)11-12-1-5-14(19)6-2-12/h1-8,23H,9-11H2,(H,20,22)/b21-16+ |
| InChIKey | OPDYWIIGSNODLN-LTGZKZEYSA-N |
| XLogP | 4.41 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|