C18H25F3O4S2 — CID 10906041
4-methoxy-3,3-dimethyl-1-(4-methylphenyl)-2-prop-2-enylthiolan-1-ium;trifluoromethanesulfonate (PubChem CID 10906041) has the molecular formula C18H25F3O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-methoxy-3,3-dimethyl-1-(4-methylphenyl)-2-prop-2-enylthiolan-1-ium;trifluoromethanesulfonate.
| Compound Name | 4-methoxy-3,3-dimethyl-1-(4-methylphenyl)-2-prop-2-enylthiolan-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10906041 |
| Molecular Formula | C18H25F3O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-methoxy-3,3-dimethyl-1-(4-methylphenyl)-2-prop-2-enylthiolan-1-ium;trifluoromethanesulfonate |
| SMILES | C=CCC1[S+](c2ccc(C)cc2)CC(OC)C1(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H25OS.CHF3O3S/c1-6-7-16-17(3,4)15(18-5)12-19(16)14-10-8-13(2)9-11-14;2-1(3,4)8(5,6)7/h6,8-11,15-16H,1,7,12H2,2-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ZTEJZFDZNKJAFC-UHFFFAOYSA-M |
| XLogP | 4.02 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|