C19H20F2O5S2 — CID 163297719
[3-[benzenesulfonyl(difluoro)methyl]cyclopentyl] 4-methylbenzenesulfonate (PubChem CID 163297719) has the molecular formula C19H20F2O5S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is [3-[benzenesulfonyl(difluoro)methyl]cyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[benzenesulfonyl(difluoro)methyl]cyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163297719 |
| Molecular Formula | C19H20F2O5S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [3-[benzenesulfonyl(difluoro)methyl]cyclopentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(C(F)(F)S(=O)(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H20F2O5S2/c1-14-7-11-18(12-8-14)28(24,25)26-16-10-9-15(13-16)19(20,21)27(22,23)17-5-3-2-4-6-17/h2-8,11-12,15-16H,9-10,13H2,1H3 |
| InChIKey | FQYHGVPESOUSQP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|