C21H24N6O3S — CID 10906314
[(1S,2R,4S,5R)-4-[6-(cyclopropylamino)purin-9-yl]-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 10906314) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-4-[6-(cyclopropylamino)purin-9-yl]-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(1S,2R,4S,5R)-4-[6-(cyclopropylamino)purin-9-yl]-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 10906314 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [(1S,2R,4S,5R)-4-[6-(cyclopropylamino)purin-9-yl]-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3[C@H](CO)C[C@H](n4cnc5c(NC6CC6)ncnc54)[C@H]32)cc1 |
| InChI | InChI=1S/C21H24N6O3S/c1-12-2-6-15(7-3-12)31(29,30)27-18-13(9-28)8-16(19(18)27)26-11-24-17-20(25-14-4-5-14)22-10-23-21(17)26/h2-3,6-7,10-11,13-14,16,18-19,28H,4-5,8-9H2,1H3,(H,22,23,25)/t13-,16-,18-,19+,27?/m0/s1 |
| InChIKey | ACIAYJOFUUORPT-ODZWRUNTSA-N |
| XLogP | 1.70 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|