C24H22F6O8S2 — CID 10908250
[(4S,5R)-1,1-dioxo-5-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydithian-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10908250) has the molecular formula C24H22F6O8S2 and a molecular weight of 616.55 g/mol. Its IUPAC name is [(4S,5R)-1,1-dioxo-5-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydithian-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4S,5R)-1,1-dioxo-5-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydithian-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10908250 |
| Molecular Formula | C24H22F6O8S2 |
| Molecular Weight | 616.55 g/mol |
| Exact Mass | 616.07 |
| IUPAC Name | [(4S,5R)-1,1-dioxo-5-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxydithian-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H]1CS(=O)(=O)SC[C@H]1OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H22F6O8S2/c1-35-21(23(25,26)27,15-9-5-3-6-10-15)19(31)37-17-13-39-40(33,34)14-18(17)38-20(32)22(36-2,24(28,29)30)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18+,21+,22+/m1/s1 |
| InChIKey | IWKVWNUYENPHER-KSCDAYEDSA-N |
| XLogP | 4.09 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|