C49H52N7O10P — CID 10909184
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-butoxy-2-[(2-phenylacetyl)amino]purin-9-yl]oxolan-3-yl] bis(2-cyanoethyl) phosphate (PubChem CID 10909184) has the molecular formula C49H52N7O10P and a molecular weight of 929.97 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-butoxy-2-[(2-phenylacetyl)amino]purin-9-yl]oxolan-3-yl] bis(2-cyanoethyl) phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-butoxy-2-[(2-phenylacetyl)amino]purin-9-yl]oxolan-3-yl] bis(2-cyanoethyl) phosphate |
|---|---|
| PubChem CID | 10909184 |
| Molecular Formula | C49H52N7O10P |
| Molecular Weight | 929.97 g/mol |
| Exact Mass | 929.35 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-butoxy-2-[(2-phenylacetyl)amino]purin-9-yl]oxolan-3-yl] bis(2-cyanoethyl) phosphate |
| SMILES | CCCCOc1nc(NC(=O)Cc2ccccc2)nc2c1ncn2[C@H]1C[C@H](OP(=O)(OCCC#N)OCCC#N)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C49H52N7O10P/c1-4-5-28-61-47-45-46(54-48(55-47)53-43(57)31-35-14-8-6-9-15-35)56(34-52-45)44-32-41(66-67(58,63-29-12-26-50)64-30-13-27-51)42(65-44)33-62-49(36-16-10-7-11-17-36,37-18-22-39(59-2)23-19-37)38-20-24-40(60-3)25-21-38/h6-11,14-25,34,41-42,44H,4-5,12-13,28-33H2,1-3H3,(H,53,54,55,57)/t41-,42+,44+/m0/s1 |
| InChIKey | YGVUVKPMBLRELB-RXAPTJIMSA-N |
| XLogP | 8.85 |
| TPSA | 211.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.97 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|