About 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one
3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 10909776) has the molecular formula C8H8O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
Analyze 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (CID 10909776) is 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is [2H]C1([2H])COC2(C=CC(=O)C=C2)O1.
What is the InChIKey of 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is MOSCBNMEESTOIU-BFWBPSQCSA-N. The full InChI is InChI=1S/C8H8O3/c9-7-1-3-8(4-2-7)10-5-6-11-8/h1-4H,5-6H2/i5D2.
What are the key properties of 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one?
3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 154.16 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dideuterio-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 10909776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).