C15H20O4 — CID 75301181
1-hydroperoxy-1,7a-dimethylspiro[4,4a,5,7-tetrahydro-3H-cyclopenta[c]pyran-6,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 75301181) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-hydroperoxy-1,7a-dimethylspiro[4,4a,5,7-tetrahydro-3H-cyclopenta[c]pyran-6,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | 1-hydroperoxy-1,7a-dimethylspiro[4,4a,5,7-tetrahydro-3H-cyclopenta[c]pyran-6,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 75301181 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-hydroperoxy-1,7a-dimethylspiro[4,4a,5,7-tetrahydro-3H-cyclopenta[c]pyran-6,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | CC1(OO)OCCC2CC3(C=CC(=O)C=C3)CC21C |
| InChI | InChI=1S/C15H20O4/c1-13-10-15(6-3-12(16)4-7-15)9-11(13)5-8-18-14(13,2)19-17/h3-4,6-7,11,17H,5,8-10H2,1-2H3 |
| InChIKey | SPAQXFBPAPSVLK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|