C16H22O4 — CID 10912844
ethyl (E,4R)-4-(2,3-dimethoxy-4-methylphenyl)pent-2-enoate (PubChem CID 10912844) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (E,4R)-4-(2,3-dimethoxy-4-methylphenyl)pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-(2,3-dimethoxy-4-methylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 10912844 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (E,4R)-4-(2,3-dimethoxy-4-methylphenyl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)c1ccc(C)c(OC)c1OC |
| InChI | InChI=1S/C16H22O4/c1-6-20-14(17)10-8-11(2)13-9-7-12(3)15(18-4)16(13)19-5/h7-11H,6H2,1-5H3/b10-8+/t11-/m1/s1 |
| InChIKey | PKTYIYAUGIRTDS-RJCSOLBVSA-N |
| XLogP | 3.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|