C13H13BrF2O3 — CID 140722310
ethyl (E,4S)-4-(4-bromo-2,6-difluorophenoxy)pent-2-enoate (PubChem CID 140722310) has the molecular formula C13H13BrF2O3 and a molecular weight of 335.14 g/mol. Its IUPAC name is ethyl (E,4S)-4-(4-bromo-2,6-difluorophenoxy)pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-(4-bromo-2,6-difluorophenoxy)pent-2-enoate |
|---|---|
| PubChem CID | 140722310 |
| Molecular Formula | C13H13BrF2O3 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | ethyl (E,4S)-4-(4-bromo-2,6-difluorophenoxy)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)Oc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H13BrF2O3/c1-3-18-12(17)5-4-8(2)19-13-10(15)6-9(14)7-11(13)16/h4-8H,3H2,1-2H3/b5-4+/t8-/m0/s1 |
| InChIKey | HAUNIFBBZDQMPE-ZJELKQJVSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|