C16H31NO2Si — CID 10913523
(7-cyano-7-trimethylsilylheptyl) 2,2-dimethylpropanoate (PubChem CID 10913523) has the molecular formula C16H31NO2Si and a molecular weight of 297.51 g/mol. Its IUPAC name is (7-cyano-7-trimethylsilylheptyl) 2,2-dimethylpropanoate.
| Compound Name | (7-cyano-7-trimethylsilylheptyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10913523 |
| Molecular Formula | C16H31NO2Si |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (7-cyano-7-trimethylsilylheptyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCCCC(C#N)[Si](C)(C)C |
| InChI | InChI=1S/C16H31NO2Si/c1-16(2,3)15(18)19-12-10-8-7-9-11-14(13-17)20(4,5)6/h14H,7-12H2,1-6H3 |
| InChIKey | UEKQPMQHYHYCIK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|