About 2-tert-butyl-1,3-benzodiselenole
2-tert-butyl-1,3-benzodiselenole (PubChem CID 10913724) has the molecular formula C11H14Se2
and a molecular weight of 304.15 g/mol. Its IUPAC name is 2-tert-butyl-1,3-benzodiselenole.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3-benzodiselenole |
| PubChem CID | 10913724 |
| Molecular Formula | C11H14Se2 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 2-tert-butyl-1,3-benzodiselenole |
| SMILES | CC(C)(C)C1[Se]c2ccccc2[Se]1 |
| InChI | InChI=1S/C11H14Se2/c1-11(2,3)10-12-8-6-4-5-7-9(8)13-10/h4-7,10H,1-3H3 |
| InChIKey | TUGKFUMJMAIFND-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1,3-benzodiselenole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3-benzodiselenole?
The IUPAC name of 2-tert-butyl-1,3-benzodiselenole (CID 10913724) is 2-tert-butyl-1,3-benzodiselenole.
What is the SMILES notation for 2-tert-butyl-1,3-benzodiselenole?
The canonical SMILES for 2-tert-butyl-1,3-benzodiselenole is CC(C)(C)C1[Se]c2ccccc2[Se]1.
What is the InChIKey of 2-tert-butyl-1,3-benzodiselenole?
The InChIKey is TUGKFUMJMAIFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Se2/c1-11(2,3)10-12-8-6-4-5-7-9(8)13-10/h4-7,10H,1-3H3.
What are the key properties of 2-tert-butyl-1,3-benzodiselenole?
2-tert-butyl-1,3-benzodiselenole has a molecular weight of 304.15 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3-benzodiselenole is sourced from PubChem (CID 10913724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).