C16H15Cl2FO3 — CID 10914929
(2E,4E,6E)-8-(2,6-dichloro-4-fluorophenoxy)-3,7-dimethylocta-2,4,6-trienoic acid (PubChem CID 10914929) has the molecular formula C16H15Cl2FO3 and a molecular weight of 345.20 g/mol. Its IUPAC name is (2E,4E,6E)-8-(2,6-dichloro-4-fluorophenoxy)-3,7-dimethylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-8-(2,6-dichloro-4-fluorophenoxy)-3,7-dimethylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10914929 |
| Molecular Formula | C16H15Cl2FO3 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (2E,4E,6E)-8-(2,6-dichloro-4-fluorophenoxy)-3,7-dimethylocta-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)COc1c(Cl)cc(F)cc1Cl)=C\C(=O)O |
| InChI | InChI=1S/C16H15Cl2FO3/c1-10(6-15(20)21)4-3-5-11(2)9-22-16-13(17)7-12(19)8-14(16)18/h3-8H,9H2,1-2H3,(H,20,21)/b4-3+,10-6+,11-5+ |
| InChIKey | UBCGCKRYURMSNY-JYVCFQOWSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|