C21H40O2Si — CID 10915178
3,4-dimethyl-1-[(1R,2R)-2-prop-1-en-2-yl-2-triethylsilyloxycyclopentyl]pent-3-en-2-ol (PubChem CID 10915178) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is 3,4-dimethyl-1-[(1R,2R)-2-prop-1-en-2-yl-2-triethylsilyloxycyclopentyl]pent-3-en-2-ol.
| Compound Name | 3,4-dimethyl-1-[(1R,2R)-2-prop-1-en-2-yl-2-triethylsilyloxycyclopentyl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 10915178 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 3,4-dimethyl-1-[(1R,2R)-2-prop-1-en-2-yl-2-triethylsilyloxycyclopentyl]pent-3-en-2-ol |
| SMILES | C=C(C)[C@@]1(O[Si](CC)(CC)CC)CCC[C@@H]1CC(O)C(C)=C(C)C |
| InChI | InChI=1S/C21H40O2Si/c1-9-24(10-2,11-3)23-21(17(6)7)14-12-13-19(21)15-20(22)18(8)16(4)5/h19-20,22H,6,9-15H2,1-5,7-8H3/t19-,20?,21+/m1/s1 |
| InChIKey | OUJMBBHGLSPEPI-TYVLQRECSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|