C20H25NO4S — CID 10915768
[(1R,3aR,6aR)-1,2,3,3a,4,6a-hexahydropentalen-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 10915768) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [(1R,3aR,6aR)-1,2,3,3a,4,6a-hexahydropentalen-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [(1R,3aR,6aR)-1,2,3,3a,4,6a-hexahydropentalen-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10915768 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(1R,3aR,6aR)-1,2,3,3a,4,6a-hexahydropentalen-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)O[C@@H]2CC[C@@H]3CC=C[C@@H]32)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-14-7-10-16(11-8-14)26(23,24)21-13-3-6-18(21)20(22)25-19-12-9-15-4-2-5-17(15)19/h2,5,7-8,10-11,15,17-19H,3-4,6,9,12-13H2,1H3/t15-,17-,18-,19+/m0/s1 |
| InChIKey | VWXKZFFUVFUIOE-DSLXNQLJSA-N |
| XLogP | 3.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|