C20H23NO7S — CID 15891768
[(1R)-3-acetyl-2-hydroxy-4-oxocyclohex-2-en-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 15891768) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is [(1R)-3-acetyl-2-hydroxy-4-oxocyclohex-2-en-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [(1R)-3-acetyl-2-hydroxy-4-oxocyclohex-2-en-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15891768 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [(1R)-3-acetyl-2-hydroxy-4-oxocyclohex-2-en-1-yl] (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CC(=O)C1=C(O)[C@H](OC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(C)cc2)CCC1=O |
| InChI | InChI=1S/C20H23NO7S/c1-12-5-7-14(8-6-12)29(26,27)21-11-3-4-15(21)20(25)28-17-10-9-16(23)18(13(2)22)19(17)24/h5-8,15,17,24H,3-4,9-11H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | NVAHTNMGVHFFFU-DOTOQJQBSA-N |
| XLogP | 1.82 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|