C17H23NO4S2 — CID 98754010
[(3S)-thiolan-3-yl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 98754010) has the molecular formula C17H23NO4S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is [(3S)-thiolan-3-yl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | [(3S)-thiolan-3-yl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 98754010 |
| Molecular Formula | C17H23NO4S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [(3S)-thiolan-3-yl] (2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)O[C@H]2CCSC2)cc1 |
| InChI | InChI=1S/C17H23NO4S2/c1-13-5-7-15(8-6-13)24(20,21)18-10-3-2-4-16(18)17(19)22-14-9-11-23-12-14/h5-8,14,16H,2-4,9-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | HDJOAUHRCUANSV-GOEBONIOSA-N |
| XLogP | 2.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |