C18H26O10 — CID 10916427
ethyl (1S,2R,6R,8S,9S,10R)-9-acetyloxy-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 10916427) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is ethyl (1S,2R,6R,8S,9S,10R)-9-acetyloxy-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1S,2R,6R,8S,9S,10R)-9-acetyloxy-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 10916427 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | ethyl (1S,2R,6R,8S,9S,10R)-9-acetyloxy-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | CCOC(=O)C[C@@]1(C(=O)OCC)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O10/c1-6-22-10(20)8-18(16(21)23-7-2)14(24-9(3)19)12-11(27-18)13-15(25-12)28-17(4,5)26-13/h11-15H,6-8H2,1-5H3/t11-,12-,13+,14-,15+,18+/m0/s1 |
| InChIKey | FPIAADZVLAVRHS-QKWHFPKLSA-N |
| XLogP | 0.45 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|