C42H54O6Si — CID 10919508
(5S,7S)-1-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-9-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-7-phenylmethoxynonan-3-one (PubChem CID 10919508) has the molecular formula C42H54O6Si and a molecular weight of 682.97 g/mol. Its IUPAC name is (5S,7S)-1-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-9-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-7-phenylmethoxynonan-3-one.
| Compound Name | (5S,7S)-1-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-9-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-7-phenylmethoxynonan-3-one |
|---|---|
| PubChem CID | 10919508 |
| Molecular Formula | C42H54O6Si |
| Molecular Weight | 682.97 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | (5S,7S)-1-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-9-[(4-methoxyphenyl)methoxy]-8,8-dimethyl-7-phenylmethoxynonan-3-one |
| SMILES | COc1ccc(COCC(C)(C)[C@H](C[C@H](O)CC(=O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H54O6Si/c1-41(2,3)49(38-18-12-8-13-19-38,39-20-14-9-15-21-39)48-27-26-35(43)28-36(44)29-40(47-31-33-16-10-7-11-17-33)42(4,5)32-46-30-34-22-24-37(45-6)25-23-34/h7-25,36,40,44H,26-32H2,1-6H3/t36-,40+/m1/s1 |
| InChIKey | ILJFYDMSWIDTBF-PGSXYRMZSA-N |
| XLogP | 7.50 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.97 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|