C17H22O5S — CID 10925793
[(1R,5S,7R)-1,4-dimethyl-3-oxo-2-oxabicyclo[3.2.2]nonan-7-yl] 4-methylbenzenesulfonate (PubChem CID 10925793) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(1R,5S,7R)-1,4-dimethyl-3-oxo-2-oxabicyclo[3.2.2]nonan-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,5S,7R)-1,4-dimethyl-3-oxo-2-oxabicyclo[3.2.2]nonan-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10925793 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(1R,5S,7R)-1,4-dimethyl-3-oxo-2-oxabicyclo[3.2.2]nonan-7-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@@H]3CC[C@@]2(C)OC(=O)C3C)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-11-4-6-14(7-5-11)23(19,20)22-15-10-13-8-9-17(15,3)21-16(18)12(13)2/h4-7,12-13,15H,8-10H2,1-3H3/t12?,13-,15+,17+/m0/s1 |
| InChIKey | UPFGDZNVKZMHDA-HQVNHIIHSA-N |
| XLogP | 2.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|