C18H23N3O6 — CID 10926927
tert-butyl 3-(2-acetamidoethyl)-5-methoxy-4-nitroindole-1-carboxylate (PubChem CID 10926927) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is tert-butyl 3-(2-acetamidoethyl)-5-methoxy-4-nitroindole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-acetamidoethyl)-5-methoxy-4-nitroindole-1-carboxylate |
|---|---|
| PubChem CID | 10926927 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl 3-(2-acetamidoethyl)-5-methoxy-4-nitroindole-1-carboxylate |
| SMILES | COc1ccc2c(c(CCNC(C)=O)cn2C(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O6/c1-11(22)19-9-8-12-10-20(17(23)27-18(2,3)4)13-6-7-14(26-5)16(15(12)13)21(24)25/h6-7,10H,8-9H2,1-5H3,(H,19,22) |
| InChIKey | YKTPQYJEOJROAQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|