C17H19N2NaO5 — CID 162470818
sodium 4-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-4-oxobutanoate (PubChem CID 162470818) has the molecular formula C17H19N2NaO5 and a molecular weight of 354.34 g/mol. Its IUPAC name is sodium 4-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-4-oxobutanoate.
| Compound Name | sodium 4-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162470818 |
| Molecular Formula | C17H19N2NaO5 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | sodium 4-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-4-oxobutanoate |
| SMILES | COc1ccc2c(c1)c(CCNC(C)=O)cn2C(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H20N2O5.Na/c1-11(20)18-8-7-12-10-19(16(21)5-6-17(22)23)15-4-3-13(24-2)9-14(12)15;/h3-4,9-10H,5-8H2,1-2H3,(H,18,20)(H,22,23);/q;+1/p-1 |
| InChIKey | KQHDIZUCJXYNOM-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |