C13H13F3N2O3 — CID 101098567
2,2,2-trifluoro-N-[2-(1-hydroxy-5-methoxyindol-3-yl)ethyl]acetamide (PubChem CID 101098567) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(1-hydroxy-5-methoxyindol-3-yl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(1-hydroxy-5-methoxyindol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 101098567 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(1-hydroxy-5-methoxyindol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CCNC(=O)C(F)(F)F)cn2O |
| InChI | InChI=1S/C13H13F3N2O3/c1-21-9-2-3-11-10(6-9)8(7-18(11)20)4-5-17-12(19)13(14,15)16/h2-3,6-7,20H,4-5H2,1H3,(H,17,19) |
| InChIKey | FCHDRXFZJKPNMG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|