C14H12F7NO2Se — CID 10928281
4,4,5,5,6,6,6-heptafluoro-3,3-dimethoxy-2-phenylselanylhexanenitrile (PubChem CID 10928281) has the molecular formula C14H12F7NO2Se and a molecular weight of 438.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-3,3-dimethoxy-2-phenylselanylhexanenitrile.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-3,3-dimethoxy-2-phenylselanylhexanenitrile |
|---|---|
| PubChem CID | 10928281 |
| Molecular Formula | C14H12F7NO2Se |
| Molecular Weight | 438.20 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-3,3-dimethoxy-2-phenylselanylhexanenitrile |
| SMILES | COC(OC)(C(C#N)[Se]c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F7NO2Se/c1-23-11(24-2,12(15,16)13(17,18)14(19,20)21)10(8-22)25-9-6-4-3-5-7-9/h3-7,10H,1-2H3 |
| InChIKey | IJGYNTLTEXDPMX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|