C34H40O5 — CID 10929487
tert-butyl 2-[4-[[4-(methoxymethoxy)-3-(2-phenylethynyl)-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetate (PubChem CID 10929487) has the molecular formula C34H40O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-(methoxymethoxy)-3-(2-phenylethynyl)-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[4-(methoxymethoxy)-3-(2-phenylethynyl)-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 10929487 |
| Molecular Formula | C34H40O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | tert-butyl 2-[4-[[4-(methoxymethoxy)-3-(2-phenylethynyl)-5-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]acetate |
| SMILES | COCOc1c(C#Cc2ccccc2)cc(Cc2c(C)cc(OCC(=O)OC(C)(C)C)cc2C)cc1C(C)C |
| InChI | InChI=1S/C34H40O5/c1-23(2)30-19-27(18-28(33(30)38-22-36-8)15-14-26-12-10-9-11-13-26)20-31-24(3)16-29(17-25(31)4)37-21-32(35)39-34(5,6)7/h9-13,16-19,23H,20-22H2,1-8H3 |
| InChIKey | XUXVBHONGBPJQJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|