C25H26F3N3O10 — CID 10929967
methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetate (PubChem CID 10929967) has the molecular formula C25H26F3N3O10 and a molecular weight of 585.49 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetate.
| Compound Name | methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10929967 |
| Molecular Formula | C25H26F3N3O10 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetate |
| SMILES | COC(=O)[C@H]([C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C25H26F3N3O10/c1-12-10-31(24(37)29-20(12)34)21-19(40-14(3)33)18(39-13(2)32)17(41-21)16(22(35)38-4)30(23(36)25(26,27)28)11-15-8-6-5-7-9-15/h5-10,16-19,21H,11H2,1-4H3,(H,29,34,37)/t16-,17+,18+,19+,21+/m0/s1 |
| InChIKey | SPNBNPHNKFJQOT-HMPZBHLVSA-N |
| XLogP | 0.74 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|