About ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate
ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate (PubChem CID 10932400) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate.
Analyze ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate?
The IUPAC name of ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate (CID 10932400) is ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate.
What is the SMILES notation for ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate?
The canonical SMILES for ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate is CCOC(=O)C1=C(C)CCN1C(C)=O.
What is the InChIKey of ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate?
The InChIKey is JZSWEMHBVKLDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-4-14-10(13)9-7(2)5-6-11(9)8(3)12/h4-6H2,1-3H3.
What are the key properties of ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate?
ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate has a molecular weight of 197.23 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-acetyl-4-methyl-2,3-dihydropyrrole-5-carboxylate is sourced from PubChem (CID 10932400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).