C13H12O3 — CID 10932845
7-methoxy-3a,4-dihydro-3H-cyclopenta[c]chromen-2-one (PubChem CID 10932845) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 7-methoxy-3a,4-dihydro-3H-cyclopenta[c]chromen-2-one.
| Compound Name | 7-methoxy-3a,4-dihydro-3H-cyclopenta[c]chromen-2-one |
|---|---|
| PubChem CID | 10932845 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 7-methoxy-3a,4-dihydro-3H-cyclopenta[c]chromen-2-one |
| SMILES | COc1ccc2c(c1)OCC1CC(=O)C=C21 |
| InChI | InChI=1S/C13H12O3/c1-15-10-2-3-11-12-5-9(14)4-8(12)7-16-13(11)6-10/h2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | SRMVCMXBYUFFGQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |