C17H30O5S — CID 10936925
[(1R,2R,5S,6R)-2-prop-2-enyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl] nonane-1-sulfonate (PubChem CID 10936925) has the molecular formula C17H30O5S and a molecular weight of 346.49 g/mol. Its IUPAC name is [(1R,2R,5S,6R)-2-prop-2-enyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl] nonane-1-sulfonate.
| Compound Name | [(1R,2R,5S,6R)-2-prop-2-enyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl] nonane-1-sulfonate |
|---|---|
| PubChem CID | 10936925 |
| Molecular Formula | C17H30O5S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(1R,2R,5S,6R)-2-prop-2-enyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl] nonane-1-sulfonate |
| SMILES | C=CC[C@H]1OC[C@H](OS(=O)(=O)CCCCCCCCC)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C17H30O5S/c1-3-5-6-7-8-9-10-12-23(18,19)22-15-13-20-14(11-4-2)16-17(15)21-16/h4,14-17H,2-3,5-13H2,1H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | ICHUMKNYGNVRFQ-TWMKSMIVSA-N |
| XLogP | 3.19 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|