C12H22O12S4 — CID 155383838
bis(3-methyl-2,2-dioxooxathiolan-4-yl) butane-1,4-disulfonate (PubChem CID 155383838) has the molecular formula C12H22O12S4 and a molecular weight of 486.56 g/mol. Its IUPAC name is bis(3-methyl-2,2-dioxooxathiolan-4-yl) butane-1,4-disulfonate.
| Compound Name | bis(3-methyl-2,2-dioxooxathiolan-4-yl) butane-1,4-disulfonate |
|---|---|
| PubChem CID | 155383838 |
| Molecular Formula | C12H22O12S4 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | bis(3-methyl-2,2-dioxooxathiolan-4-yl) butane-1,4-disulfonate |
| SMILES | CC1C(OS(=O)(=O)CCCCS(=O)(=O)OC2COS(=O)(=O)C2C)COS1(=O)=O |
| InChI | InChI=1S/C12H22O12S4/c1-9-11(7-21-27(9,17)18)23-25(13,14)5-3-4-6-26(15,16)24-12-8-22-28(19,20)10(12)2/h9-12H,3-8H2,1-2H3 |
| InChIKey | ORVZHFYYMPZZJU-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|