About bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate
bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate (PubChem CID 155384270) has the molecular formula C11H20O12S4
and a molecular weight of 472.54 g/mol. Its IUPAC name is bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate.
Molecular Properties
| Compound Name | bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate |
| PubChem CID | 155384270 |
| Molecular Formula | C11H20O12S4 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate |
| SMILES | CC1C(OS(=O)(=O)C(C)(C)S(=O)(=O)OC2COS(=O)(=O)C2C)COS1(=O)=O |
| InChI | InChI=1S/C11H20O12S4/c1-7-9(5-20-24(7,12)13)22-26(16,17)11(3,4)27(18,19)23-10-6-21-25(14,15)8(10)2/h7-10H,5-6H2,1-4H3 |
| InChIKey | WJJZPPBWIAYLGH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate?
The IUPAC name of bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate (CID 155384270) is bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate.
What is the SMILES notation for bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate?
The canonical SMILES for bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate is CC1C(OS(=O)(=O)C(C)(C)S(=O)(=O)OC2COS(=O)(=O)C2C)COS1(=O)=O.
What is the InChIKey of bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate?
The InChIKey is WJJZPPBWIAYLGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O12S4/c1-7-9(5-20-24(7,12)13)22-26(16,17)11(3,4)27(18,19)23-10-6-21-25(14,15)8(10)2/h7-10H,5-6H2,1-4H3.
What are the key properties of bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate?
bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate has a molecular weight of 472.54 g/mol, XLogP of -1.35, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methyl-2,2-dioxooxathiolan-4-yl) propane-2,2-disulfonate is sourced from PubChem (CID 155384270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).