C17H32F3N5O2 — CID 109378469
2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 109378469) has the molecular formula C17H32F3N5O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 109378469 |
| Molecular Formula | C17H32F3N5O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H32F3N5O2/c1-5-27-12-6-7-21-16(22-13-15(26)23(3)4)25-10-8-24(9-11-25)14(2)17(18,19)20/h14H,5-13H2,1-4H3,(H,21,22) |
| InChIKey | XXWGNRRVKCBOSY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|